ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
| Ονομασία του προϊόντος |
methyl 2-[(cyanomethyl)thio]benzoate |
| Συνώνυμα |
methyl 2-[(cyanomethyl)sulfanyl]benzoate |
| MF |
C10H9NO2S |
| Μοριακό βάρος |
207.249 |
| InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
| CAS ΟΧΙ |
57601-89-5 |
| Μοριακή δομή |
![57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate](https://images-a.chemnet.com/suppliers/chembase/143/14321.gif)
|
| Πυκνότητα |
1.24g/cm3 |
| Σημείο τήξης |
121℃ |
| Σημείο βρασμού |
338.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.574 |
| Σημείο ανάφλεξης |
158.6°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
